C26H33NO3Si — CID 102459740
2-[dihydroxy-(2,4,6-trimethylphenyl)silyl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide (PubChem CID 102459740) has the molecular formula C26H33NO3Si and a molecular weight of 435.64 g/mol. Its IUPAC name is 2-[dihydroxy-(2,4,6-trimethylphenyl)silyl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide.
| Compound Name | 2-[dihydroxy-(2,4,6-trimethylphenyl)silyl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 102459740 |
| Molecular Formula | C26H33NO3Si |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-[dihydroxy-(2,4,6-trimethylphenyl)silyl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide |
| SMILES | Cc1cc(C)c([Si](O)(O)c2ccc3ccccc3c2C(=O)N(C(C)C)C(C)C)c(C)c1 |
| InChI | InChI=1S/C26H33NO3Si/c1-16(2)27(17(3)4)26(28)24-22-11-9-8-10-21(22)12-13-23(24)31(29,30)25-19(6)14-18(5)15-20(25)7/h8-17,29-30H,1-7H3 |
| InChIKey | KRPIYBIDAYHCIN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|