About 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene]
4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene] (PubChem CID 102460003) has the molecular formula C26H22F3NO
and a molecular weight of 421.46 g/mol. Its IUPAC name is 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene].
Molecular Properties
| Compound Name | 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene] |
| PubChem CID | 102460003 |
| Molecular Formula | C26H22F3NO |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene] |
| SMILES | CCCCC1C(c2ccc(C(F)(F)F)cc2)=NOC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C26H22F3NO/c1-2-3-10-23-24(17-13-15-18(16-14-17)26(27,28)29)30-31-25(23)21-11-6-4-8-19(21)20-9-5-7-12-22(20)25/h4-9,11-16,23H,2-3,10H2,1H3 |
| InChIKey | ATOADJGBHBWVNK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene]?
The IUPAC name of 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene] (CID 102460003) is 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene].
What is the SMILES notation for 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene]?
The canonical SMILES for 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene] is CCCCC1C(c2ccc(C(F)(F)F)cc2)=NOC12c1ccccc1-c1ccccc12.
What is the InChIKey of 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene]?
The InChIKey is ATOADJGBHBWVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22F3NO/c1-2-3-10-23-24(17-13-15-18(16-14-17)26(27,28)29)30-31-25(23)21-11-6-4-8-19(21)20-9-5-7-12-22(20)25/h4-9,11-16,23H,2-3,10H2,1H3.
What are the key properties of 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene]?
4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene] has a molecular weight of 421.46 g/mol, XLogP of 7.17, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-3-[4-(trifluoromethyl)phenyl]spiro[4H-1,2-oxazole-5,9'-fluorene] is sourced from PubChem (CID 102460003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).