C17H23N3O4SSi — CID 102460279
methyl (1aR,2S,7bS)-2-cyano-1-(2-trimethylsilylethylsulfonyl)-2,7b-dihydro-1aH-azirino[2,3-c]quinoline-3-carboxylate (PubChem CID 102460279) has the molecular formula C17H23N3O4SSi and a molecular weight of 393.54 g/mol. Its IUPAC name is methyl (1aR,2S,7bS)-2-cyano-1-(2-trimethylsilylethylsulfonyl)-2,7b-dihydro-1aH-azirino[2,3-c]quinoline-3-carboxylate.
| Compound Name | methyl (1aR,2S,7bS)-2-cyano-1-(2-trimethylsilylethylsulfonyl)-2,7b-dihydro-1aH-azirino[2,3-c]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 102460279 |
| Molecular Formula | C17H23N3O4SSi |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | methyl (1aR,2S,7bS)-2-cyano-1-(2-trimethylsilylethylsulfonyl)-2,7b-dihydro-1aH-azirino[2,3-c]quinoline-3-carboxylate |
| SMILES | COC(=O)N1c2ccccc2[C@H]2[C@@H]([C@H]1C#N)N2S(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C17H23N3O4SSi/c1-24-17(21)19-13-8-6-5-7-12(13)15-16(14(19)11-18)20(15)25(22,23)9-10-26(2,3)4/h5-8,14-16H,9-10H2,1-4H3/t14-,15+,16-,20?/m1/s1 |
| InChIKey | YFKXKOQBJVFONE-DQNOFRGOSA-N |
| XLogP | 2.56 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|