C17H21FN2O4 — CID 102460315
tert-butyl (2S,3R)-2-(3-fluorophenyl)-6-methyl-3-nitro-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 102460315) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-(3-fluorophenyl)-6-methyl-3-nitro-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-(3-fluorophenyl)-6-methyl-3-nitro-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 102460315 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | tert-butyl (2S,3R)-2-(3-fluorophenyl)-6-methyl-3-nitro-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC1=CC[C@@H]([N+](=O)[O-])[C@H](c2cccc(F)c2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21FN2O4/c1-11-8-9-14(20(22)23)15(12-6-5-7-13(18)10-12)19(11)16(21)24-17(2,3)4/h5-8,10,14-15H,9H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | MFRZHWWWFXZCQU-CABCVRRESA-N |
| XLogP | 4.06 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|