About dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate
dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate (PubChem CID 102460349) has the molecular formula C13H17NO4S
and a molecular weight of 283.35 g/mol. Its IUPAC name is dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate |
| PubChem CID | 102460349 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate |
| SMILES | C=CC/N=C1\SC(C=C)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H17NO4S/c1-5-7-14-10-13(11(15)17-3,12(16)18-4)8-9(6-2)19-10/h5-6,9H,1-2,7-8H2,3-4H3/b14-10- |
| InChIKey | OCRJFNAEHUBRIM-UVTDQMKNSA-N |
| XLogP | 1.59 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate?
The IUPAC name of dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate (CID 102460349) is dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate.
What is the SMILES notation for dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate?
The canonical SMILES for dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate is C=CC/N=C1\SC(C=C)CC1(C(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate?
The InChIKey is OCRJFNAEHUBRIM-UVTDQMKNSA-N. The full InChI is InChI=1S/C13H17NO4S/c1-5-7-14-10-13(11(15)17-3,12(16)18-4)8-9(6-2)19-10/h5-6,9H,1-2,7-8H2,3-4H3/b14-10-.
What are the key properties of dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate?
dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate has a molecular weight of 283.35 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5-ethenyl-2-prop-2-enyliminothiolane-3,3-dicarboxylate is sourced from PubChem (CID 102460349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).