About [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate
[difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate (PubChem CID 102460911) has the molecular formula C10H17F2O5P
and a molecular weight of 286.21 g/mol. Its IUPAC name is [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate.
Molecular Properties
| Compound Name | [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate |
| PubChem CID | 102460911 |
| Molecular Formula | C10H17F2O5P |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate |
| SMILES | C=CC[C@@H](O)[C@@H]1C[C@H]1C(F)(F)OP(=O)(OC)OC |
| InChI | InChI=1S/C10H17F2O5P/c1-4-5-9(13)7-6-8(7)10(11,12)17-18(14,15-2)16-3/h4,7-9,13H,1,5-6H2,2-3H3/t7-,8-,9-/m1/s1 |
| InChIKey | XKYCAIHREMKEDD-IWSPIJDZSA-N |
| XLogP | 2.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate?
The IUPAC name of [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate (CID 102460911) is [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate.
What is the SMILES notation for [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate?
The canonical SMILES for [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate is C=CC[C@@H](O)[C@@H]1C[C@H]1C(F)(F)OP(=O)(OC)OC.
What is the InChIKey of [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate?
The InChIKey is XKYCAIHREMKEDD-IWSPIJDZSA-N. The full InChI is InChI=1S/C10H17F2O5P/c1-4-5-9(13)7-6-8(7)10(11,12)17-18(14,15-2)16-3/h4,7-9,13H,1,5-6H2,2-3H3/t7-,8-,9-/m1/s1.
What are the key properties of [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate?
[difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate has a molecular weight of 286.21 g/mol, XLogP of 2.57, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [difluoro-[(1R,2R)-2-[(1R)-1-hydroxybut-3-enyl]cyclopropyl]methyl] dimethyl phosphate is sourced from PubChem (CID 102460911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).