About 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride
3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride (PubChem CID 10246114) has the molecular formula C17H8Cl2OS
and a molecular weight of 331.22 g/mol. Its IUPAC name is 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride.
Molecular Properties
| Compound Name | 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride |
| PubChem CID | 10246114 |
| Molecular Formula | C17H8Cl2OS |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride |
| SMILES | O=C(Cl)c1sc2c3ccccc3c3ccccc3c2c1Cl |
| InChI | InChI=1S/C17H8Cl2OS/c18-14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15(13)21-16(14)17(19)20/h1-8H |
| InChIKey | FSJJCUMOQOBMIH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride?
The IUPAC name of 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride (CID 10246114) is 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride.
What is the SMILES notation for 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride?
The canonical SMILES for 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride is O=C(Cl)c1sc2c3ccccc3c3ccccc3c2c1Cl.
What is the InChIKey of 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride?
The InChIKey is FSJJCUMOQOBMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8Cl2OS/c18-14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)15(13)21-16(14)17(19)20/h1-8H.
What are the key properties of 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride?
3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride has a molecular weight of 331.22 g/mol, XLogP of 6.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorophenanthro[9,10-b]thiophene-2-carbonyl chloride is sourced from PubChem (CID 10246114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).