About 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene
6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene (PubChem CID 102461302) has the molecular formula C9H11ClO2
and a molecular weight of 186.64 g/mol. Its IUPAC name is 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene |
| PubChem CID | 102461302 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene |
| SMILES | C=C1C=C(OC)C=C(OC)C1Cl |
| InChI | InChI=1S/C9H11ClO2/c1-6-4-7(11-2)5-8(12-3)9(6)10/h4-5,9H,1H2,2-3H3 |
| InChIKey | ALQHZDGJQYAFHP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene?
The IUPAC name of 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene (CID 102461302) is 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene.
What is the SMILES notation for 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene?
The canonical SMILES for 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene is C=C1C=C(OC)C=C(OC)C1Cl.
What is the InChIKey of 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene?
The InChIKey is ALQHZDGJQYAFHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO2/c1-6-4-7(11-2)5-8(12-3)9(6)10/h4-5,9H,1H2,2-3H3.
What are the key properties of 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene?
6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene has a molecular weight of 186.64 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene is sourced from PubChem (CID 102461302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).