C17H20N2O3Se — CID 102461368
(1R,2R,6S,9R)-4-methyl-9-(phenylselanylmethyl)-7-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione (PubChem CID 102461368) has the molecular formula C17H20N2O3Se and a molecular weight of 379.32 g/mol. Its IUPAC name is (1R,2R,6S,9R)-4-methyl-9-(phenylselanylmethyl)-7-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione.
| Compound Name | (1R,2R,6S,9R)-4-methyl-9-(phenylselanylmethyl)-7-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione |
|---|---|
| PubChem CID | 102461368 |
| Molecular Formula | C17H20N2O3Se |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | (1R,2R,6S,9R)-4-methyl-9-(phenylselanylmethyl)-7-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione |
| SMILES | CN1C(=O)[C@H]2[C@H](ON3[C@@H](C[Se]c4ccccc4)CCC[C@H]23)C1=O |
| InChI | InChI=1S/C17H20N2O3Se/c1-18-16(20)14-13-9-5-6-11(19(13)22-15(14)17(18)21)10-23-12-7-3-2-4-8-12/h2-4,7-8,11,13-15H,5-6,9-10H2,1H3/t11-,13-,14-,15+/m1/s1 |
| InChIKey | RITYKHVGMYWXHU-NGFQHRJXSA-N |
| XLogP | 0.59 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|