About 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol
1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol (PubChem CID 10246141) has the molecular formula C21H21N3O
and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol.
Molecular Properties
| Compound Name | 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol |
| PubChem CID | 10246141 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol |
| SMILES | CN(C)C(Cc1ccccc1)c1nccc2c1[nH]c1ccc(O)cc12 |
| InChI | InChI=1S/C21H21N3O/c1-24(2)19(12-14-6-4-3-5-7-14)21-20-16(10-11-22-21)17-13-15(25)8-9-18(17)23-20/h3-11,13,19,23,25H,12H2,1-2H3 |
| InChIKey | RHWHMFSBROSYKE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol?
The IUPAC name of 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol (CID 10246141) is 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol.
What is the SMILES notation for 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol?
The canonical SMILES for 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol is CN(C)C(Cc1ccccc1)c1nccc2c1[nH]c1ccc(O)cc12.
What is the InChIKey of 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol?
The InChIKey is RHWHMFSBROSYKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O/c1-24(2)19(12-14-6-4-3-5-7-14)21-20-16(10-11-22-21)17-13-15(25)8-9-18(17)23-20/h3-11,13,19,23,25H,12H2,1-2H3.
What are the key properties of 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol?
1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol has a molecular weight of 331.42 g/mol, XLogP of 4.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(dimethylamino)-2-phenylethyl]-9H-pyrido[3,4-b]indol-6-ol is sourced from PubChem (CID 10246141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).