C16H22O3 — CID 102461483
(3'aS,6'aR)-3',3'-bis(prop-2-enyl)spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-one (PubChem CID 102461483) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (3'aS,6'aR)-3',3'-bis(prop-2-enyl)spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-one.
| Compound Name | (3'aS,6'aR)-3',3'-bis(prop-2-enyl)spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-one |
|---|---|
| PubChem CID | 102461483 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (3'aS,6'aR)-3',3'-bis(prop-2-enyl)spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-one |
| SMILES | C=CCC1(CC=C)C(=O)C[C@@H]2CC3(C[C@@H]21)OCCO3 |
| InChI | InChI=1S/C16H22O3/c1-3-5-15(6-4-2)13-11-16(18-7-8-19-16)10-12(13)9-14(15)17/h3-4,12-13H,1-2,5-11H2/t12-,13+/m1/s1 |
| InChIKey | PQPSPERRJBYDQD-OLZOCXBDSA-N |
| XLogP | 2.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|