About 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile
2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile (PubChem CID 102461510) has the molecular formula C15H12N8O2
and a molecular weight of 336.32 g/mol. Its IUPAC name is 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile |
| PubChem CID | 102461510 |
| Molecular Formula | C15H12N8O2 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile |
| SMILES | Cn1c(OCCCOc2nc(C#N)c(C#N)n2C)nc(C#N)c1C#N |
| InChI | InChI=1S/C15H12N8O2/c1-22-12(8-18)10(6-16)20-14(22)24-4-3-5-25-15-21-11(7-17)13(9-19)23(15)2/h3-5H2,1-2H3 |
| InChIKey | YLCNBQJXGHNSNQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 149.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile?
The IUPAC name of 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile (CID 102461510) is 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile.
What is the SMILES notation for 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile?
The canonical SMILES for 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile is Cn1c(OCCCOc2nc(C#N)c(C#N)n2C)nc(C#N)c1C#N.
What is the InChIKey of 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile?
The InChIKey is YLCNBQJXGHNSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N8O2/c1-22-12(8-18)10(6-16)20-14(22)24-4-3-5-25-15-21-11(7-17)13(9-19)23(15)2/h3-5H2,1-2H3.
What are the key properties of 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile?
2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile has a molecular weight of 336.32 g/mol, XLogP of 0.49, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4,5-dicyano-1-methylimidazol-2-yl)oxypropoxy]-1-methylimidazole-4,5-dicarbonitrile is sourced from PubChem (CID 102461510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).