C20H28O4 — CID 10246193
(1'R,3'aS,9'S,10'bS)-9'-hydroxy-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,9,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one (PubChem CID 10246193) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1'R,3'aS,9'S,10'bS)-9'-hydroxy-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,9,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one.
| Compound Name | (1'R,3'aS,9'S,10'bS)-9'-hydroxy-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,9,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one |
|---|---|
| PubChem CID | 10246193 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1'R,3'aS,9'S,10'bS)-9'-hydroxy-3'a-methyl-1'-propan-2-ylspiro[1,3-dioxolane-2,6'-2,3,7,8,9,10b-hexahydro-1H-cyclohepta[e]indene]-4'-one |
| SMILES | CC(C)[C@H]1CC[C@]2(C)C(=O)C=C3C(=C[C@@H](O)CCC34OCCO4)[C@H]12 |
| InChI | InChI=1S/C20H28O4/c1-12(2)14-5-6-19(3)17(22)11-16-15(18(14)19)10-13(21)4-7-20(16)23-8-9-24-20/h10-14,18,21H,4-9H2,1-3H3/t13-,14+,18-,19+/m0/s1 |
| InChIKey | DXFUKIBDYBHFQL-QABNGEJJSA-N |
| XLogP | 3.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |