C31H28O5S — CID 102462313
[(E)-1-(benzenesulfonyl)-3-methyl-4-phenyl-1-phenylmethoxybut-3-en-2-yl] benzoate (PubChem CID 102462313) has the molecular formula C31H28O5S and a molecular weight of 512.63 g/mol. Its IUPAC name is [(E)-1-(benzenesulfonyl)-3-methyl-4-phenyl-1-phenylmethoxybut-3-en-2-yl] benzoate.
| Compound Name | [(E)-1-(benzenesulfonyl)-3-methyl-4-phenyl-1-phenylmethoxybut-3-en-2-yl] benzoate |
|---|---|
| PubChem CID | 102462313 |
| Molecular Formula | C31H28O5S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | [(E)-1-(benzenesulfonyl)-3-methyl-4-phenyl-1-phenylmethoxybut-3-en-2-yl] benzoate |
| SMILES | C/C(=C\c1ccccc1)C(OC(=O)c1ccccc1)C(OCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H28O5S/c1-24(22-25-14-6-2-7-15-25)29(36-30(32)27-18-10-4-11-19-27)31(35-23-26-16-8-3-9-17-26)37(33,34)28-20-12-5-13-21-28/h2-22,29,31H,23H2,1H3/b24-22+ |
| InChIKey | KMEHVERXMCEWAZ-ZNTNEXAZSA-N |
| XLogP | 6.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |