About ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate
ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate (PubChem CID 10246273) has the molecular formula C20H18N2O3
and a molecular weight of 334.38 g/mol. Its IUPAC name is ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate |
| PubChem CID | 10246273 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate |
| SMILES | CCOC(=O)c1nccc2c(C)c3c(cc12)c1cc(O)ccc1n3C |
| InChI | InChI=1S/C20H18N2O3/c1-4-25-20(24)18-15-10-16-14-9-12(23)5-6-17(14)22(3)19(16)11(2)13(15)7-8-21-18/h5-10,23H,4H2,1-3H3 |
| InChIKey | UUCZWCYFBWQUPA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate?
The IUPAC name of ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate (CID 10246273) is ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate.
What is the SMILES notation for ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate?
The canonical SMILES for ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate is CCOC(=O)c1nccc2c(C)c3c(cc12)c1cc(O)ccc1n3C.
What is the InChIKey of ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate?
The InChIKey is UUCZWCYFBWQUPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-4-25-20(24)18-15-10-16-14-9-12(23)5-6-17(14)22(3)19(16)11(2)13(15)7-8-21-18/h5-10,23H,4H2,1-3H3.
What are the key properties of ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate?
ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate has a molecular weight of 334.38 g/mol, XLogP of 4.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxylate is sourced from PubChem (CID 10246273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).