C40H72GeSi6 — CID 102463714
[[2-(4,11b-dihydro-1H-germino[2,1-a][2]benzogermin-5-yl)-3,5-bis[bis(trimethylsilyl)methyl]phenyl]-trimethylsilylmethyl]-trimethylsilane (PubChem CID 102463714) has the molecular formula C40H72GeSi6 and a molecular weight of 794.14 g/mol. Its IUPAC name is [[2-(4,11b-dihydro-1H-germino[2,1-a][2]benzogermin-5-yl)-3,5-bis[bis(trimethylsilyl)methyl]phenyl]-trimethylsilylmethyl]-trimethylsilane.
| Compound Name | [[2-(4,11b-dihydro-1H-germino[2,1-a][2]benzogermin-5-yl)-3,5-bis[bis(trimethylsilyl)methyl]phenyl]-trimethylsilylmethyl]-trimethylsilane |
|---|---|
| PubChem CID | 102463714 |
| Molecular Formula | C40H72GeSi6 |
| Molecular Weight | 794.14 g/mol |
| Exact Mass | 794.35 |
| IUPAC Name | [[2-(4,11b-dihydro-1H-germino[2,1-a][2]benzogermin-5-yl)-3,5-bis[bis(trimethylsilyl)methyl]phenyl]-trimethylsilylmethyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(c1cc(C([Si](C)(C)C)[Si](C)(C)C)c([Ge]23C=Cc4ccccc4C2CC=CC3)c(C([Si](C)(C)C)[Si](C)(C)C)c1)[Si](C)(C)C |
| InChI | InChI=1S/C40H72GeSi6/c1-42(2,3)38(43(4,5)6)32-29-34(39(44(7,8)9)45(10,11)12)37(35(30-32)40(46(13,14)15)47(16,17)18)41-27-22-21-25-36(41)33-24-20-19-23-31(33)26-28-41/h19-24,26,28-30,36,38-40H,25,27H2,1-18H3 |
| InChIKey | MMJRXQCDARBKTI-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.14 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|