About [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane
[(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane (PubChem CID 102463717) has the molecular formula C13H24O2Si
and a molecular weight of 240.42 g/mol. Its IUPAC name is [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane |
| PubChem CID | 102463717 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane |
| SMILES | COCO[C@H]1CC=C[C@@H]1C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C13H24O2Si/c1-14-11-15-13-9-5-7-12(13)8-6-10-16(2,3)4/h5-7,10,12-13H,8-9,11H2,1-4H3/b10-6+/t12-,13+/m1/s1 |
| InChIKey | IJAFLMILLZPZIJ-QFPXWBCESA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane?
The IUPAC name of [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane (CID 102463717) is [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane.
What is the SMILES notation for [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane?
The canonical SMILES for [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane is COCO[C@H]1CC=C[C@@H]1C/C=C/[Si](C)(C)C.
What is the InChIKey of [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane?
The InChIKey is IJAFLMILLZPZIJ-QFPXWBCESA-N. The full InChI is InChI=1S/C13H24O2Si/c1-14-11-15-13-9-5-7-12(13)8-6-10-16(2,3)4/h5-7,10,12-13H,8-9,11H2,1-4H3/b10-6+/t12-,13+/m1/s1.
What are the key properties of [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane?
[(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane has a molecular weight of 240.42 g/mol, XLogP of 3.38, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-[(1S,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]prop-1-enyl]-trimethylsilane is sourced from PubChem (CID 102463717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).