C20H17FN2O2 — CID 10246393
15-[2-(dimethylamino)ethyl]-4-fluoro-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione (PubChem CID 10246393) has the molecular formula C20H17FN2O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is 15-[2-(dimethylamino)ethyl]-4-fluoro-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione.
| Compound Name | 15-[2-(dimethylamino)ethyl]-4-fluoro-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione |
|---|---|
| PubChem CID | 10246393 |
| Molecular Formula | C20H17FN2O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 15-[2-(dimethylamino)ethyl]-4-fluoro-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione |
| SMILES | CN(C)CCN1C(=O)c2cccc3cc4ccc(F)cc4c(c23)C1=O |
| InChI | InChI=1S/C20H17FN2O2/c1-22(2)8-9-23-19(24)15-5-3-4-13-10-12-6-7-14(21)11-16(12)18(17(13)15)20(23)25/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | UTRDZYGJHPDYQI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|