C20H24NO4P — CID 102464206
2-(4,4-diphenyl-5H-1,3-oxazol-2-yl)propan-2-yl dimethyl phosphite (PubChem CID 102464206) has the molecular formula C20H24NO4P and a molecular weight of 373.39 g/mol. Its IUPAC name is 2-(4,4-diphenyl-5H-1,3-oxazol-2-yl)propan-2-yl dimethyl phosphite.
| Compound Name | 2-(4,4-diphenyl-5H-1,3-oxazol-2-yl)propan-2-yl dimethyl phosphite |
|---|---|
| PubChem CID | 102464206 |
| Molecular Formula | C20H24NO4P |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-(4,4-diphenyl-5H-1,3-oxazol-2-yl)propan-2-yl dimethyl phosphite |
| SMILES | COP(OC)OC(C)(C)C1=NC(c2ccccc2)(c2ccccc2)CO1 |
| InChI | InChI=1S/C20H24NO4P/c1-19(2,25-26(22-3)23-4)18-21-20(15-24-18,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14H,15H2,1-4H3 |
| InChIKey | JUQXDJBXVKOMKS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|