C14H13ClN4O4 — CID 10246433
2-(chloromethyl)-5,10-dihydroxy-3,7,8-trimethylpyrimido[4,5-g]quinazoline-4,9-dione (PubChem CID 10246433) has the molecular formula C14H13ClN4O4 and a molecular weight of 336.74 g/mol. Its IUPAC name is 2-(chloromethyl)-5,10-dihydroxy-3,7,8-trimethylpyrimido[4,5-g]quinazoline-4,9-dione.
| Compound Name | 2-(chloromethyl)-5,10-dihydroxy-3,7,8-trimethylpyrimido[4,5-g]quinazoline-4,9-dione |
|---|---|
| PubChem CID | 10246433 |
| Molecular Formula | C14H13ClN4O4 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-(chloromethyl)-5,10-dihydroxy-3,7,8-trimethylpyrimido[4,5-g]quinazoline-4,9-dione |
| SMILES | Cc1nc2c(O)c3c(=O)n(C)c(CCl)nc3c(O)c2c(=O)n1C |
| InChI | InChI=1S/C14H13ClN4O4/c1-5-16-9-7(13(22)18(5)2)12(21)10-8(11(9)20)14(23)19(3)6(4-15)17-10/h20-21H,4H2,1-3H3 |
| InChIKey | SGSMCLXVPXCYHO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|