C36H50O23 — CID 102464617
[(2R,3R,4S,5R,6R)-4,6-diacetyloxy-3,5-bis[[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 102464617) has the molecular formula C36H50O23 and a molecular weight of 850.77 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,6-diacetyloxy-3,5-bis[[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,6-diacetyloxy-3,5-bis[[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102464617 |
| Molecular Formula | C36H50O23 |
| Molecular Weight | 850.77 g/mol |
| Exact Mass | 850.27 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,6-diacetyloxy-3,5-bis[[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@H](O[C@H]2O[C@@H](C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O[C@H]1O[C@@H](C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C36H50O23/c1-13-25(49-16(4)38)28(51-18(6)40)31(54-21(9)43)34(47-13)58-27-24(12-46-15(3)37)57-36(56-23(11)45)33(30(27)53-20(8)42)59-35-32(55-22(10)44)29(52-19(7)41)26(14(2)48-35)50-17(5)39/h13-14,24-36H,12H2,1-11H3/t13-,14-,24+,25+,26+,27+,28+,29+,30-,31-,32-,33+,34+,35+,36-/m0/s1 |
| InChIKey | MGDKEVNPJZUODW-BMUCVLGRSA-N |
| XLogP | -0.38 |
| TPSA | 282.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.77 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|