About hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine
hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine (PubChem CID 102464891) has the molecular formula C13H18N+
and a molecular weight of 188.29 g/mol. Its IUPAC name is hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine.
Molecular Properties
| Compound Name | hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine |
| PubChem CID | 102464891 |
| Molecular Formula | C13H18N+ |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine |
| SMILES | [H+].[H]/N=C/C=C1/C=C\C(=C\C=C)CCCC1 |
| InChI | InChI=1S/C13H17N/c1-2-5-12-6-3-4-7-13(9-8-12)10-11-14/h2,5,8-11,14H,1,3-4,6-7H2/p+1/b9-8-,12-5+,13-10+,14-11+ |
| InChIKey | MOGZDHVMRNAWPC-KCRJFXAOSA-O |
| XLogP | 3.92 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine?
The IUPAC name of hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine (CID 102464891) is hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine.
What is the SMILES notation for hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine?
The canonical SMILES for hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine is [H+].[H]/N=C/C=C1/C=C\C(=C\C=C)CCCC1.
What is the InChIKey of hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine?
The InChIKey is MOGZDHVMRNAWPC-KCRJFXAOSA-O. The full InChI is InChI=1S/C13H17N/c1-2-5-12-6-3-4-7-13(9-8-12)10-11-14/h2,5,8-11,14H,1,3-4,6-7H2/p+1/b9-8-,12-5+,13-10+,14-11+.
What are the key properties of hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine?
hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine has a molecular weight of 188.29 g/mol, XLogP of 3.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine is sourced from PubChem (CID 102464891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).