C16H22O3S — CID 102466200
(1R,2S,6S,8S)-8-(benzenesulfonyl)-2,6-dimethylbicyclo[4.2.0]octan-1-ol (PubChem CID 102466200) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is (1R,2S,6S,8S)-8-(benzenesulfonyl)-2,6-dimethylbicyclo[4.2.0]octan-1-ol.
| Compound Name | (1R,2S,6S,8S)-8-(benzenesulfonyl)-2,6-dimethylbicyclo[4.2.0]octan-1-ol |
|---|---|
| PubChem CID | 102466200 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (1R,2S,6S,8S)-8-(benzenesulfonyl)-2,6-dimethylbicyclo[4.2.0]octan-1-ol |
| SMILES | C[C@H]1CCC[C@@]2(C)C[C@H](S(=O)(=O)c3ccccc3)[C@@]12O |
| InChI | InChI=1S/C16H22O3S/c1-12-7-6-10-15(2)11-14(16(12,15)17)20(18,19)13-8-4-3-5-9-13/h3-5,8-9,12,14,17H,6-7,10-11H2,1-2H3/t12-,14-,15-,16-/m0/s1 |
| InChIKey | SFXJBWMMASVBFH-TUUVXOQKSA-N |
| XLogP | 2.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |