About 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate
4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate (PubChem CID 10246677) has the molecular formula C8H13BrN4S3
and a molecular weight of 341.33 g/mol. Its IUPAC name is 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate.
Molecular Properties
| Compound Name | 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate |
| PubChem CID | 10246677 |
| Molecular Formula | C8H13BrN4S3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate |
| SMILES | CSc1nc(N)n(C(=S)SCCCCBr)n1 |
| InChI | InChI=1S/C8H13BrN4S3/c1-15-7-11-6(10)13(12-7)8(14)16-5-3-2-4-9/h2-5H2,1H3,(H2,10,11,12) |
| InChIKey | AWOMEXGFEYYBNV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate?
The IUPAC name of 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate (CID 10246677) is 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate.
What is the SMILES notation for 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate?
The canonical SMILES for 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate is CSc1nc(N)n(C(=S)SCCCCBr)n1.
What is the InChIKey of 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate?
The InChIKey is AWOMEXGFEYYBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrN4S3/c1-15-7-11-6(10)13(12-7)8(14)16-5-3-2-4-9/h2-5H2,1H3,(H2,10,11,12).
What are the key properties of 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate?
4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate has a molecular weight of 341.33 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobutyl 5-amino-3-methylsulfanyl-1,2,4-triazole-1-carbodithioate is sourced from PubChem (CID 10246677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).