C20H20O4 — CID 102466908
(1S,2R,3S,4R,8S,9R,17R,18R)-6-oxahexacyclo[16.2.1.02,17.03,15.04,8.09,14]henicosa-14,19-diene-5,7,16-trione (PubChem CID 102466908) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (1S,2R,3S,4R,8S,9R,17R,18R)-6-oxahexacyclo[16.2.1.02,17.03,15.04,8.09,14]henicosa-14,19-diene-5,7,16-trione.
| Compound Name | (1S,2R,3S,4R,8S,9R,17R,18R)-6-oxahexacyclo[16.2.1.02,17.03,15.04,8.09,14]henicosa-14,19-diene-5,7,16-trione |
|---|---|
| PubChem CID | 102466908 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (1S,2R,3S,4R,8S,9R,17R,18R)-6-oxahexacyclo[16.2.1.02,17.03,15.04,8.09,14]henicosa-14,19-diene-5,7,16-trione |
| SMILES | O=C1OC(=O)[C@@H]2[C@H]1[C@H]1C(=C3CCCC[C@@H]32)C(=O)[C@H]2[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C20H20O4/c21-18-13-9-6-5-8(7-9)12(13)16-14(18)10-3-1-2-4-11(10)15-17(16)20(23)24-19(15)22/h5-6,8-9,11-13,15-17H,1-4,7H2/t8-,9+,11+,12+,13-,15+,16-,17+/m1/s1 |
| InChIKey | QRBVJIWBAOEDRO-HCXLFACTSA-N |
| XLogP | 2.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|