About 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium
10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium (PubChem CID 102467184) has the molecular formula C30H28O2S2+2
and a molecular weight of 484.69 g/mol. Its IUPAC name is 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium.
Molecular Properties
| Compound Name | 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium |
| PubChem CID | 102467184 |
| Molecular Formula | C30H28O2S2+2 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium |
| SMILES | CC(C)([S+]1c2ccccc2Oc2ccccc21)C(C)(C)[S+]1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C30H28O2S2/c1-29(2,33-25-17-9-5-13-21(25)31-22-14-6-10-18-26(22)33)30(3,4)34-27-19-11-7-15-23(27)32-24-16-8-12-20-28(24)34/h5-20H,1-4H3/q+2 |
| InChIKey | XTSBVLCTDINKBZ-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium?
The IUPAC name of 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium (CID 102467184) is 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium.
What is the SMILES notation for 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium?
The canonical SMILES for 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium is CC(C)([S+]1c2ccccc2Oc2ccccc21)C(C)(C)[S+]1c2ccccc2Oc2ccccc21.
What is the InChIKey of 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium?
The InChIKey is XTSBVLCTDINKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28O2S2/c1-29(2,33-25-17-9-5-13-21(25)31-22-14-6-10-18-26(22)33)30(3,4)34-27-19-11-7-15-23(27)32-24-16-8-12-20-28(24)34/h5-20H,1-4H3/q+2.
What are the key properties of 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium?
10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium has a molecular weight of 484.69 g/mol, XLogP of 8.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2,3-dimethyl-3-phenoxathiin-10-ium-10-ylbutan-2-yl)phenoxathiin-10-ium is sourced from PubChem (CID 102467184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).