C15H20F9NO2S — CID 102467259
1,1,2,2,3,3,4,4,4-nonafluoro-N-undeca-4,5-dienylbutane-1-sulfonamide (PubChem CID 102467259) has the molecular formula C15H20F9NO2S and a molecular weight of 449.38 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-undeca-4,5-dienylbutane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-undeca-4,5-dienylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 102467259 |
| Molecular Formula | C15H20F9NO2S |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-undeca-4,5-dienylbutane-1-sulfonamide |
| SMILES | CCCCCC=C=CCCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H20F9NO2S/c1-2-3-4-5-6-7-8-9-10-11-25-28(26,27)15(23,24)13(18,19)12(16,17)14(20,21)22/h6,8,25H,2-5,9-11H2,1H3 |
| InChIKey | YWMRHNJCRFIWAN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|