About 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene
1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene (PubChem CID 102467393) has the molecular formula C10H11ClN2O4
and a molecular weight of 258.66 g/mol. Its IUPAC name is 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene.
Molecular Properties
| Compound Name | 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene |
| PubChem CID | 102467393 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene |
| SMILES | C[C@H]([C@@H](C[N+](=O)[O-])c1ccc(Cl)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C10H11ClN2O4/c1-7(13(16)17)10(6-12(14)15)8-2-4-9(11)5-3-8/h2-5,7,10H,6H2,1H3/t7-,10-/m1/s1 |
| InChIKey | CUWFCTDZCXHXCF-GMSGAONNSA-N |
| XLogP | 2.37 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene?
The IUPAC name of 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene (CID 102467393) is 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene.
What is the SMILES notation for 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene?
The canonical SMILES for 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene is C[C@H]([C@@H](C[N+](=O)[O-])c1ccc(Cl)cc1)[N+](=O)[O-].
What is the InChIKey of 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene?
The InChIKey is CUWFCTDZCXHXCF-GMSGAONNSA-N. The full InChI is InChI=1S/C10H11ClN2O4/c1-7(13(16)17)10(6-12(14)15)8-2-4-9(11)5-3-8/h2-5,7,10H,6H2,1H3/t7-,10-/m1/s1.
What are the key properties of 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene?
1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene has a molecular weight of 258.66 g/mol, XLogP of 2.37, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[(2R,3R)-1,3-dinitrobutan-2-yl]benzene is sourced from PubChem (CID 102467393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).