About 3,5-dimethyl-2-sulfanylbenzene-1,4-diol
3,5-dimethyl-2-sulfanylbenzene-1,4-diol (PubChem CID 102467791) has the molecular formula C8H10O2S
and a molecular weight of 170.23 g/mol. Its IUPAC name is 3,5-dimethyl-2-sulfanylbenzene-1,4-diol.
Molecular Properties
| Compound Name | 3,5-dimethyl-2-sulfanylbenzene-1,4-diol |
| PubChem CID | 102467791 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 3,5-dimethyl-2-sulfanylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(S)c(C)c1O |
| InChI | InChI=1S/C8H10O2S/c1-4-3-6(9)8(11)5(2)7(4)10/h3,9-11H,1-2H3 |
| InChIKey | GZIILRNTHJLDGA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-2-sulfanylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2-sulfanylbenzene-1,4-diol?
The IUPAC name of 3,5-dimethyl-2-sulfanylbenzene-1,4-diol (CID 102467791) is 3,5-dimethyl-2-sulfanylbenzene-1,4-diol.
What is the SMILES notation for 3,5-dimethyl-2-sulfanylbenzene-1,4-diol?
The canonical SMILES for 3,5-dimethyl-2-sulfanylbenzene-1,4-diol is Cc1cc(O)c(S)c(C)c1O.
What is the InChIKey of 3,5-dimethyl-2-sulfanylbenzene-1,4-diol?
The InChIKey is GZIILRNTHJLDGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S/c1-4-3-6(9)8(11)5(2)7(4)10/h3,9-11H,1-2H3.
What are the key properties of 3,5-dimethyl-2-sulfanylbenzene-1,4-diol?
3,5-dimethyl-2-sulfanylbenzene-1,4-diol has a molecular weight of 170.23 g/mol, XLogP of 2.00, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2-sulfanylbenzene-1,4-diol is sourced from PubChem (CID 102467791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).