About 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine
2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine (PubChem CID 10246789) has the molecular formula C19H22N2O2S
and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine |
| PubChem CID | 10246789 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine |
| SMILES | Cc1c(S(=O)(=O)c2ccccc2)c2ccccc2n1CCN(C)C |
| InChI | InChI=1S/C19H22N2O2S/c1-15-19(24(22,23)16-9-5-4-6-10-16)17-11-7-8-12-18(17)21(15)14-13-20(2)3/h4-12H,13-14H2,1-3H3 |
| InChIKey | RIFXMYBRJYQMTK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine (CID 10246789) is 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine is Cc1c(S(=O)(=O)c2ccccc2)c2ccccc2n1CCN(C)C.
What is the InChIKey of 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine?
The InChIKey is RIFXMYBRJYQMTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2S/c1-15-19(24(22,23)16-9-5-4-6-10-16)17-11-7-8-12-18(17)21(15)14-13-20(2)3/h4-12H,13-14H2,1-3H3.
What are the key properties of 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine?
2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine has a molecular weight of 342.46 g/mol, XLogP of 3.34, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(benzenesulfonyl)-2-methylindol-1-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 10246789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).