C13H14F5NO4 — CID 10246813
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidine-3,4,5-triol (PubChem CID 10246813) has the molecular formula C13H14F5NO4 and a molecular weight of 343.25 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 10246813 |
| Molecular Formula | C13H14F5NO4 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(2,3,4,5,6-pentafluorophenyl)methyl]piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H14F5NO4/c14-7-4(8(15)10(17)11(18)9(7)16)1-19-2-6(21)13(23)12(22)5(19)3-20/h5-6,12-13,20-23H,1-3H2/t5-,6+,12-,13-/m1/s1 |
| InChIKey | VYPGXPLGHYHIRV-PLSZNQMNSA-N |
| XLogP | -0.36 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|