C20H22N2 — CID 102469075
N-benzylidene-N'-cyclohexylbenzenecarboximidamide (PubChem CID 102469075) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-benzylidene-N'-cyclohexylbenzenecarboximidamide.
| Compound Name | N-benzylidene-N'-cyclohexylbenzenecarboximidamide |
|---|---|
| PubChem CID | 102469075 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-benzylidene-N'-cyclohexylbenzenecarboximidamide |
| SMILES | C(=N/C(=N\C1CCCCC1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C20H22N2/c1-4-10-17(11-5-1)16-21-20(18-12-6-2-7-13-18)22-19-14-8-3-9-15-19/h1-2,4-7,10-13,16,19H,3,8-9,14-15H2/b21-16+,22-20- |
| InChIKey | VGVXBZOQCQIVQX-HALTTXAASA-N |
| XLogP | 4.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|