C40H36N2O2 — CID 102469425
2-[[[(1R,2R)-2-[(2-hydroxy-5-phenylphenyl)methylamino]-1,2-diphenylethyl]amino]methyl]-4-phenylphenol (PubChem CID 102469425) has the molecular formula C40H36N2O2 and a molecular weight of 576.74 g/mol. Its IUPAC name is 2-[[[(1R,2R)-2-[(2-hydroxy-5-phenylphenyl)methylamino]-1,2-diphenylethyl]amino]methyl]-4-phenylphenol.
| Compound Name | 2-[[[(1R,2R)-2-[(2-hydroxy-5-phenylphenyl)methylamino]-1,2-diphenylethyl]amino]methyl]-4-phenylphenol |
|---|---|
| PubChem CID | 102469425 |
| Molecular Formula | C40H36N2O2 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | 2-[[[(1R,2R)-2-[(2-hydroxy-5-phenylphenyl)methylamino]-1,2-diphenylethyl]amino]methyl]-4-phenylphenol |
| SMILES | Oc1ccc(-c2ccccc2)cc1CN[C@H](c1ccccc1)[C@H](NCc1cc(-c2ccccc2)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C40H36N2O2/c43-37-23-21-33(29-13-5-1-6-14-29)25-35(37)27-41-39(31-17-9-3-10-18-31)40(32-19-11-4-12-20-32)42-28-36-26-34(22-24-38(36)44)30-15-7-2-8-16-30/h1-26,39-44H,27-28H2/t39-,40-/m1/s1 |
| InChIKey | WGHVJCXAVDCGCO-XRSDMRJBSA-N |
| XLogP | 8.79 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|