C39H44Br2O2 — CID 102469919
9-[3,4-bis(2-ethylbutoxy)phenyl]-2,7-dibromo-9-(2,5-dimethylphenyl)fluorene (PubChem CID 102469919) has the molecular formula C39H44Br2O2 and a molecular weight of 704.59 g/mol. Its IUPAC name is 9-[3,4-bis(2-ethylbutoxy)phenyl]-2,7-dibromo-9-(2,5-dimethylphenyl)fluorene.
| Compound Name | 9-[3,4-bis(2-ethylbutoxy)phenyl]-2,7-dibromo-9-(2,5-dimethylphenyl)fluorene |
|---|---|
| PubChem CID | 102469919 |
| Molecular Formula | C39H44Br2O2 |
| Molecular Weight | 704.59 g/mol |
| Exact Mass | 702.17 |
| IUPAC Name | 9-[3,4-bis(2-ethylbutoxy)phenyl]-2,7-dibromo-9-(2,5-dimethylphenyl)fluorene |
| SMILES | CCC(CC)COc1ccc(C2(c3cc(C)ccc3C)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1OCC(CC)CC |
| InChI | InChI=1S/C39H44Br2O2/c1-7-27(8-2)23-42-37-18-13-29(20-38(37)43-24-28(9-3)10-4)39(34-19-25(5)11-12-26(34)6)35-21-30(40)14-16-32(35)33-17-15-31(41)22-36(33)39/h11-22,27-28H,7-10,23-24H2,1-6H3 |
| InChIKey | JVRQHEDZDKCFIX-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.59 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |