C27H28N4O3 — CID 102470277
2,3-bis[2-[4-(2-hydroxyethyl)-2-pyridinyl]-4-pyridinyl]propan-1-ol (PubChem CID 102470277) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2,3-bis[2-[4-(2-hydroxyethyl)-2-pyridinyl]-4-pyridinyl]propan-1-ol.
| Compound Name | 2,3-bis[2-[4-(2-hydroxyethyl)-2-pyridinyl]-4-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 102470277 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2,3-bis[2-[4-(2-hydroxyethyl)-2-pyridinyl]-4-pyridinyl]propan-1-ol |
| SMILES | OCCc1ccnc(-c2cc(CC(CO)c3ccnc(-c4cc(CCO)ccn4)c3)ccn2)c1 |
| InChI | InChI=1S/C27H28N4O3/c32-11-5-19-1-7-28-24(14-19)26-16-21(3-9-30-26)13-23(18-34)22-4-10-31-27(17-22)25-15-20(6-12-33)2-8-29-25/h1-4,7-10,14-17,23,32-34H,5-6,11-13,18H2 |
| InChIKey | GPQLAGPRAVWJKK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |