C18H18O3S — CID 102470798
[(1E,3Z)-3-(benzenesulfonyl)-5-methoxypenta-1,3-dienyl]benzene (PubChem CID 102470798) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is [(1E,3Z)-3-(benzenesulfonyl)-5-methoxypenta-1,3-dienyl]benzene.
| Compound Name | [(1E,3Z)-3-(benzenesulfonyl)-5-methoxypenta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 102470798 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [(1E,3Z)-3-(benzenesulfonyl)-5-methoxypenta-1,3-dienyl]benzene |
| SMILES | COC/C=C(/C=C/c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18O3S/c1-21-15-14-18(13-12-16-8-4-2-5-9-16)22(19,20)17-10-6-3-7-11-17/h2-14H,15H2,1H3/b13-12+,18-14- |
| InChIKey | VUBOKHIVPKXAQP-LWOKMJCDSA-N |
| XLogP | 3.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|