C15H25NO — CID 102470871
N,2-dicyclohexylprop-2-enamide (PubChem CID 102470871) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N,2-dicyclohexylprop-2-enamide.
| Compound Name | N,2-dicyclohexylprop-2-enamide |
|---|---|
| PubChem CID | 102470871 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N,2-dicyclohexylprop-2-enamide |
| SMILES | C=C(C(=O)NC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C15H25NO/c1-12(13-8-4-2-5-9-13)15(17)16-14-10-6-3-7-11-14/h13-14H,1-11H2,(H,16,17) |
| InChIKey | LTQOGUSUBPAQMM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|