C35H37N5O2S — CID 102471007
1-[2-[3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]ethyl]-3-phenylthiourea (PubChem CID 102471007) has the molecular formula C35H37N5O2S and a molecular weight of 591.78 g/mol. Its IUPAC name is 1-[2-[3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]ethyl]-3-phenylthiourea.
| Compound Name | 1-[2-[3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]ethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 102471007 |
| Molecular Formula | C35H37N5O2S |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | 1-[2-[3',6'-bis(ethylamino)-2',7'-dimethyl-3-oxospiro[isoindole-1,9'-xanthene]-2-yl]ethyl]-3-phenylthiourea |
| SMILES | CCNc1cc2c(cc1C)C1(c3cc(C)c(NCC)cc3O2)c2ccccc2C(=O)N1CCNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C35H37N5O2S/c1-5-36-29-20-31-27(18-22(29)3)35(28-19-23(4)30(37-6-2)21-32(28)42-31)26-15-11-10-14-25(26)33(41)40(35)17-16-38-34(43)39-24-12-8-7-9-13-24/h7-15,18-21,36-37H,5-6,16-17H2,1-4H3,(H2,38,39,43) |
| InChIKey | WNHRXGJCFLZWDH-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|