About [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate
[(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 102471043) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate.
Molecular Properties
| Compound Name | [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate |
| PubChem CID | 102471043 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)[C@H]1C=C[C@@H](OC(=O)N(C(C)C)C(C)C)CC1 |
| InChI | InChI=1S/C16H29NO2/c1-11(2)14-7-9-15(10-8-14)19-16(18)17(12(3)4)13(5)6/h7,9,11-15H,8,10H2,1-6H3/t14-,15+/m0/s1 |
| InChIKey | WRTLMSXQAAKPMJ-LSDHHAIUSA-N |
| XLogP | 4.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate?
The IUPAC name of [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate (CID 102471043) is [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate.
What is the SMILES notation for [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate?
The canonical SMILES for [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate is CC(C)[C@H]1C=C[C@@H](OC(=O)N(C(C)C)C(C)C)CC1.
What is the InChIKey of [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate?
The InChIKey is WRTLMSXQAAKPMJ-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H29NO2/c1-11(2)14-7-9-15(10-8-14)19-16(18)17(12(3)4)13(5)6/h7,9,11-15H,8,10H2,1-6H3/t14-,15+/m0/s1.
What are the key properties of [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate?
[(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate has a molecular weight of 267.41 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,4S)-4-propan-2-ylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamate is sourced from PubChem (CID 102471043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).