C23H19NO4 — CID 102471440
benzyl (1R,12S)-9,14-dimethyl-2-oxo-15-oxa-13-azatetracyclo[10.2.1.01,10.03,8]pentadeca-3,5,7,10,13-pentaene-11-carboxylate (PubChem CID 102471440) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is benzyl (1R,12S)-9,14-dimethyl-2-oxo-15-oxa-13-azatetracyclo[10.2.1.01,10.03,8]pentadeca-3,5,7,10,13-pentaene-11-carboxylate.
| Compound Name | benzyl (1R,12S)-9,14-dimethyl-2-oxo-15-oxa-13-azatetracyclo[10.2.1.01,10.03,8]pentadeca-3,5,7,10,13-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 102471440 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | benzyl (1R,12S)-9,14-dimethyl-2-oxo-15-oxa-13-azatetracyclo[10.2.1.01,10.03,8]pentadeca-3,5,7,10,13-pentaene-11-carboxylate |
| SMILES | CC1=N[C@H]2O[C@@]13C(=O)c1ccccc1C(C)C3=C2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H19NO4/c1-13-16-10-6-7-11-17(16)20(25)23-14(2)24-21(28-23)18(19(13)23)22(26)27-12-15-8-4-3-5-9-15/h3-11,13,21H,12H2,1-2H3/t13?,21-,23-/m0/s1 |
| InChIKey | BTTFEGJGSIWXBV-KJUYIIGUSA-N |
| XLogP | 3.60 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |