C26H33B3O6Si2 — CID 102471553
1,5-ditert-butyl-3,7,10-triphenyl-2,4,6,8,9,11-hexaoxa-1,5-disila-3,7,10-triborabicyclo[3.3.3]undecane (PubChem CID 102471553) has the molecular formula C26H33B3O6Si2 and a molecular weight of 530.15 g/mol. Its IUPAC name is 1,5-ditert-butyl-3,7,10-triphenyl-2,4,6,8,9,11-hexaoxa-1,5-disila-3,7,10-triborabicyclo[3.3.3]undecane.
| Compound Name | 1,5-ditert-butyl-3,7,10-triphenyl-2,4,6,8,9,11-hexaoxa-1,5-disila-3,7,10-triborabicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 102471553 |
| Molecular Formula | C26H33B3O6Si2 |
| Molecular Weight | 530.15 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 1,5-ditert-butyl-3,7,10-triphenyl-2,4,6,8,9,11-hexaoxa-1,5-disila-3,7,10-triborabicyclo[3.3.3]undecane |
| SMILES | CC(C)(C)[Si]12OB(c3ccccc3)O[Si](C(C)(C)C)(OB(c3ccccc3)O1)OB(c1ccccc1)O2 |
| InChI | InChI=1S/C26H33B3O6Si2/c1-25(2,3)36-30-27(22-16-10-7-11-17-22)33-37(26(4,5)6,34-28(31-36)23-18-12-8-13-19-23)35-29(32-36)24-20-14-9-15-21-24/h7-21H,1-6H3 |
| InChIKey | CLVBDQIAKYUARL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.15 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|