About (5S)-5-methyl-1,3-dithiolane-2,4-dione
(5S)-5-methyl-1,3-dithiolane-2,4-dione (PubChem CID 102471952) has the molecular formula C4H4O2S2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (5S)-5-methyl-1,3-dithiolane-2,4-dione.
Molecular Properties
| Compound Name | (5S)-5-methyl-1,3-dithiolane-2,4-dione |
| PubChem CID | 102471952 |
| Molecular Formula | C4H4O2S2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 147.97 |
| IUPAC Name | (5S)-5-methyl-1,3-dithiolane-2,4-dione |
| SMILES | C[C@@H]1SC(=O)SC1=O |
| InChI | InChI=1S/C4H4O2S2/c1-2-3(5)8-4(6)7-2/h2H,1H3/t2-/m0/s1 |
| InChIKey | LWDCBBAYSHHADT-REOHCLBHSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-methyl-1,3-dithiolane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methyl-1,3-dithiolane-2,4-dione?
The IUPAC name of (5S)-5-methyl-1,3-dithiolane-2,4-dione (CID 102471952) is (5S)-5-methyl-1,3-dithiolane-2,4-dione.
What is the SMILES notation for (5S)-5-methyl-1,3-dithiolane-2,4-dione?
The canonical SMILES for (5S)-5-methyl-1,3-dithiolane-2,4-dione is C[C@@H]1SC(=O)SC1=O.
What is the InChIKey of (5S)-5-methyl-1,3-dithiolane-2,4-dione?
The InChIKey is LWDCBBAYSHHADT-REOHCLBHSA-N. The full InChI is InChI=1S/C4H4O2S2/c1-2-3(5)8-4(6)7-2/h2H,1H3/t2-/m0/s1.
What are the key properties of (5S)-5-methyl-1,3-dithiolane-2,4-dione?
(5S)-5-methyl-1,3-dithiolane-2,4-dione has a molecular weight of 148.21 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methyl-1,3-dithiolane-2,4-dione is sourced from PubChem (CID 102471952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).