C13H17BrClF3O — CID 102472337
1-bromo-2-[(1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropyl]pent-4-en-2-ol (PubChem CID 102472337) has the molecular formula C13H17BrClF3O and a molecular weight of 361.63 g/mol. Its IUPAC name is 1-bromo-2-[(1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropyl]pent-4-en-2-ol.
| Compound Name | 1-bromo-2-[(1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropyl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 102472337 |
| Molecular Formula | C13H17BrClF3O |
| Molecular Weight | 361.63 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 1-bromo-2-[(1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropyl]pent-4-en-2-ol |
| SMILES | C=CCC(O)(CBr)[C@H]1[C@@H](/C=C(\Cl)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C13H17BrClF3O/c1-4-5-12(19,7-14)10-8(11(10,2)3)6-9(15)13(16,17)18/h4,6,8,10,19H,1,5,7H2,2-3H3/b9-6-/t8-,10+,12?/m1/s1 |
| InChIKey | ACQYGIJMQHUPJK-VWNYJNAISA-N |
| XLogP | 4.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|