C25H20N2O6 — CID 102472594
methyl (2S)-2-[(3aS,5R,7aR)-1,3-dioxo-2-phenyl-3a,4,5,7a-tetrahydroisoindol-5-yl]-2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 102472594) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is methyl (2S)-2-[(3aS,5R,7aR)-1,3-dioxo-2-phenyl-3a,4,5,7a-tetrahydroisoindol-5-yl]-2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | methyl (2S)-2-[(3aS,5R,7aR)-1,3-dioxo-2-phenyl-3a,4,5,7a-tetrahydroisoindol-5-yl]-2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 102472594 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | methyl (2S)-2-[(3aS,5R,7aR)-1,3-dioxo-2-phenyl-3a,4,5,7a-tetrahydroisoindol-5-yl]-2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | COC(=O)[C@H]([C@H]1C=C[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2C1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H20N2O6/c1-33-25(32)20(27-22(29)16-9-5-6-10-17(16)23(27)30)14-11-12-18-19(13-14)24(31)26(21(18)28)15-7-3-2-4-8-15/h2-12,14,18-20H,13H2,1H3/t14-,18+,19-,20-/m0/s1 |
| InChIKey | GPVZBFJBKQZPFI-WBCYEJBOSA-N |
| XLogP | 2.21 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|