C24H31NO — CID 10247264
(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 10247264) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 10247264 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3ccccn3)=CC[C@@H]12 |
| InChI | InChI=1S/C24H31NO/c1-23-12-10-17(26)15-16(23)6-7-18-19-8-9-21(22-5-3-4-14-25-22)24(19,2)13-11-20(18)23/h3-6,9,14,17-20,26H,7-8,10-13,15H2,1-2H3/t17-,18-,19-,20-,23-,24-/m0/s1 |
| InChIKey | IZUINOWPAPJQQC-IGJOJHROSA-N |
| XLogP | 5.40 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|