C12H16O3 — CID 102473460
(2aR,5aR,9aR)-5a-methyl-3,4,5,7,8,9-hexahydro-2aH-naphtho[4a,5-b]oxete-2,6-dione (PubChem CID 102473460) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2aR,5aR,9aR)-5a-methyl-3,4,5,7,8,9-hexahydro-2aH-naphtho[4a,5-b]oxete-2,6-dione.
| Compound Name | (2aR,5aR,9aR)-5a-methyl-3,4,5,7,8,9-hexahydro-2aH-naphtho[4a,5-b]oxete-2,6-dione |
|---|---|
| PubChem CID | 102473460 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2aR,5aR,9aR)-5a-methyl-3,4,5,7,8,9-hexahydro-2aH-naphtho[4a,5-b]oxete-2,6-dione |
| SMILES | C[C@@]12CCC[C@H]3C(=O)O[C@]31CCCC2=O |
| InChI | InChI=1S/C12H16O3/c1-11-6-2-4-8-10(14)15-12(8,11)7-3-5-9(11)13/h8H,2-7H2,1H3/t8-,11-,12+/m0/s1 |
| InChIKey | UEIHGLDANQUVIX-KPXOXKRLSA-N |
| XLogP | 1.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|