C23H21F6NO4P2 — CID 102473571
(1R)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-N-diphenylphosphoryl-1-phenylmethanamine (PubChem CID 102473571) has the molecular formula C23H21F6NO4P2 and a molecular weight of 551.36 g/mol. Its IUPAC name is (1R)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-N-diphenylphosphoryl-1-phenylmethanamine.
| Compound Name | (1R)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-N-diphenylphosphoryl-1-phenylmethanamine |
|---|---|
| PubChem CID | 102473571 |
| Molecular Formula | C23H21F6NO4P2 |
| Molecular Weight | 551.36 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | (1R)-1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-N-diphenylphosphoryl-1-phenylmethanamine |
| SMILES | O=P(N[C@@H](c1ccccc1)P(=O)(OCC(F)(F)F)OCC(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21F6NO4P2/c24-22(25,26)16-33-36(32,34-17-23(27,28)29)21(18-10-4-1-5-11-18)30-35(31,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21H,16-17H2,(H,30,31)/t21-/m1/s1 |
| InChIKey | VAFOMDFEKJWLKJ-OAQYLSRUSA-N |
| XLogP | 6.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.36 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|