About 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine
5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 10247379) has the molecular formula C23H17N3O
and a molecular weight of 351.41 g/mol. Its IUPAC name is 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 10247379 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1ccc(Oc2ccccc2-c2cnc3[nH]cc(-c4cc[nH]c4)c3c2)cc1 |
| InChI | InChI=1S/C23H17N3O/c1-2-6-18(7-3-1)27-22-9-5-4-8-19(22)17-12-20-21(16-10-11-24-13-16)15-26-23(20)25-14-17/h1-15,24H,(H,25,26) |
| InChIKey | QXWDWPMQRFHXIO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine (CID 10247379) is 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine is c1ccc(Oc2ccccc2-c2cnc3[nH]cc(-c4cc[nH]c4)c3c2)cc1.
What is the InChIKey of 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is QXWDWPMQRFHXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O/c1-2-6-18(7-3-1)27-22-9-5-4-8-19(22)17-12-20-21(16-10-11-24-13-16)15-26-23(20)25-14-17/h1-15,24H,(H,25,26).
What are the key properties of 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine?
5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 351.41 g/mol, XLogP of 6.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-phenoxyphenyl)-3-(1H-pyrrol-3-yl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 10247379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).