C26H40 — CID 102473889
(3E,7E,11E)-7,8-dibutyl-2,2,13,13-tetramethyltetradeca-3,7,11-trien-5,9-diyne (PubChem CID 102473889) has the molecular formula C26H40 and a molecular weight of 352.61 g/mol. Its IUPAC name is (3E,7E,11E)-7,8-dibutyl-2,2,13,13-tetramethyltetradeca-3,7,11-trien-5,9-diyne.
| Compound Name | (3E,7E,11E)-7,8-dibutyl-2,2,13,13-tetramethyltetradeca-3,7,11-trien-5,9-diyne |
|---|---|
| PubChem CID | 102473889 |
| Molecular Formula | C26H40 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | (3E,7E,11E)-7,8-dibutyl-2,2,13,13-tetramethyltetradeca-3,7,11-trien-5,9-diyne |
| SMILES | CCCC/C(C#C/C=C/C(C)(C)C)=C(\C#C/C=C/C(C)(C)C)CCCC |
| InChI | InChI=1S/C26H40/c1-9-11-17-23(19-13-15-21-25(3,4)5)24(18-12-10-2)20-14-16-22-26(6,7)8/h15-16,21-22H,9-12,17-18H2,1-8H3/b21-15+,22-16+,24-23+ |
| InChIKey | GWZVJFIKPAWXKS-MDBFFVCLSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|