About 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline
4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline (PubChem CID 10247401) has the molecular formula C19H17N3S2
and a molecular weight of 351.50 g/mol. Its IUPAC name is 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline |
| PubChem CID | 10247401 |
| Molecular Formula | C19H17N3S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc(-c3cccs3)c(-c3cccs3)[nH]2)cc1 |
| InChI | InChI=1S/C19H17N3S2/c1-22(2)14-9-7-13(8-10-14)19-20-17(15-5-3-11-23-15)18(21-19)16-6-4-12-24-16/h3-12H,1-2H3,(H,20,21) |
| InChIKey | WEJPNZIYGAWPIG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline?
The IUPAC name of 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline (CID 10247401) is 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline.
What is the SMILES notation for 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline?
The canonical SMILES for 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline is CN(C)c1ccc(-c2nc(-c3cccs3)c(-c3cccs3)[nH]2)cc1.
What is the InChIKey of 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline?
The InChIKey is WEJPNZIYGAWPIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3S2/c1-22(2)14-9-7-13(8-10-14)19-20-17(15-5-3-11-23-15)18(21-19)16-6-4-12-24-16/h3-12H,1-2H3,(H,20,21).
What are the key properties of 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline?
4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline has a molecular weight of 351.50 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dithiophen-2-yl-1H-imidazol-2-yl)-N,N-dimethylaniline is sourced from PubChem (CID 10247401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).